C19H17F2N5O2S — CID 42991364
N-[(E)-[4-(difluoromethoxy)phenyl]methylideneamino]-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]benzamide (PubChem CID 42991364) has the molecular formula C19H17F2N5O2S and a molecular weight of 417.44 g/mol. Its IUPAC name is N-[(E)-[4-(difluoromethoxy)phenyl]methylideneamino]-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]benzamide.
| Compound Name | N-[(E)-[4-(difluoromethoxy)phenyl]methylideneamino]-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]benzamide |
|---|---|
| PubChem CID | 42991364 |
| Molecular Formula | C19H17F2N5O2S |
| Molecular Weight | 417.44 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | N-[(E)-[4-(difluoromethoxy)phenyl]methylideneamino]-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]benzamide |
| SMILES | Cn1cnnc1SCc1ccc(C(=O)N/N=C/c2ccc(OC(F)F)cc2)cc1 |
| InChI | InChI=1S/C19H17F2N5O2S/c1-26-12-23-25-19(26)29-11-14-2-6-15(7-3-14)17(27)24-22-10-13-4-8-16(9-5-13)28-18(20)21/h2-10,12,18H,11H2,1H3,(H,24,27)/b22-10+ |
| InChIKey | DOLFMYKAKBGLMH-LSHDLFTRSA-N |
| XLogP | 3.47 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.44 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|