C27H26N6O4 — CID 24541970
3,4-dimethoxy-N'-[4-[(5-phenyltetrazol-2-yl)methyl]benzoyl]-5-prop-2-enylbenzohydrazide (PubChem CID 24541970) has the molecular formula C27H26N6O4 and a molecular weight of 498.54 g/mol. Its IUPAC name is 3,4-dimethoxy-N'-[4-[(5-phenyltetrazol-2-yl)methyl]benzoyl]-5-prop-2-enylbenzohydrazide.
| Compound Name | 3,4-dimethoxy-N'-[4-[(5-phenyltetrazol-2-yl)methyl]benzoyl]-5-prop-2-enylbenzohydrazide |
|---|---|
| PubChem CID | 24541970 |
| Molecular Formula | C27H26N6O4 |
| Molecular Weight | 498.54 g/mol |
| Exact Mass | 498.20 |
| IUPAC Name | 3,4-dimethoxy-N'-[4-[(5-phenyltetrazol-2-yl)methyl]benzoyl]-5-prop-2-enylbenzohydrazide |
| SMILES | C=CCc1cc(C(=O)NNC(=O)c2ccc(Cn3nnc(-c4ccccc4)n3)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C27H26N6O4/c1-4-8-21-15-22(16-23(36-2)24(21)37-3)27(35)30-29-26(34)20-13-11-18(12-14-20)17-33-31-25(28-32-33)19-9-6-5-7-10-19/h4-7,9-16H,1,8,17H2,2-3H3,(H,29,34)(H,30,35) |
| InChIKey | VXNUMXQMIWADHT-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 120.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.54 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|