C26H20N6O2 — CID 24541843
N'-[4-[(5-phenyltetrazol-2-yl)methyl]benzoyl]naphthalene-2-carbohydrazide (PubChem CID 24541843) has the molecular formula C26H20N6O2 and a molecular weight of 448.49 g/mol. Its IUPAC name is N'-[4-[(5-phenyltetrazol-2-yl)methyl]benzoyl]naphthalene-2-carbohydrazide.
| Compound Name | N'-[4-[(5-phenyltetrazol-2-yl)methyl]benzoyl]naphthalene-2-carbohydrazide |
|---|---|
| PubChem CID | 24541843 |
| Molecular Formula | C26H20N6O2 |
| Molecular Weight | 448.49 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | N'-[4-[(5-phenyltetrazol-2-yl)methyl]benzoyl]naphthalene-2-carbohydrazide |
| SMILES | O=C(NNC(=O)c1ccc2ccccc2c1)c1ccc(Cn2nnc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C26H20N6O2/c33-25(28-29-26(34)23-15-14-19-6-4-5-9-22(19)16-23)21-12-10-18(11-13-21)17-32-30-24(27-31-32)20-7-2-1-3-8-20/h1-16H,17H2,(H,28,33)(H,29,34) |
| InChIKey | PDPPTBZUPHAZEL-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.49 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|