C23H19ClN6O2S — CID 55376043
N'-[2-(4-chlorophenyl)sulfanylacetyl]-4-[(5-phenyltetrazol-2-yl)methyl]benzohydrazide (PubChem CID 55376043) has the molecular formula C23H19ClN6O2S and a molecular weight of 478.97 g/mol. Its IUPAC name is N'-[2-(4-chlorophenyl)sulfanylacetyl]-4-[(5-phenyltetrazol-2-yl)methyl]benzohydrazide.
| Compound Name | N'-[2-(4-chlorophenyl)sulfanylacetyl]-4-[(5-phenyltetrazol-2-yl)methyl]benzohydrazide |
|---|---|
| PubChem CID | 55376043 |
| Molecular Formula | C23H19ClN6O2S |
| Molecular Weight | 478.97 g/mol |
| Exact Mass | 478.10 |
| IUPAC Name | N'-[2-(4-chlorophenyl)sulfanylacetyl]-4-[(5-phenyltetrazol-2-yl)methyl]benzohydrazide |
| SMILES | O=C(CSc1ccc(Cl)cc1)NNC(=O)c1ccc(Cn2nnc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C23H19ClN6O2S/c24-19-10-12-20(13-11-19)33-15-21(31)25-27-23(32)18-8-6-16(7-9-18)14-30-28-22(26-29-30)17-4-2-1-3-5-17/h1-13H,14-15H2,(H,25,31)(H,27,32) |
| InChIKey | PCOLIXYCSZYWLZ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.97 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|