C26H23N7O3 — CID 55376248
(E)-N-[2-oxo-2-[2-[4-[(5-phenyltetrazol-2-yl)methyl]benzoyl]hydrazinyl]ethyl]-3-phenylprop-2-enamide (PubChem CID 55376248) has the molecular formula C26H23N7O3 and a molecular weight of 481.52 g/mol. Its IUPAC name is (E)-N-[2-oxo-2-[2-[4-[(5-phenyltetrazol-2-yl)methyl]benzoyl]hydrazinyl]ethyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[2-oxo-2-[2-[4-[(5-phenyltetrazol-2-yl)methyl]benzoyl]hydrazinyl]ethyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 55376248 |
| Molecular Formula | C26H23N7O3 |
| Molecular Weight | 481.52 g/mol |
| Exact Mass | 481.19 |
| IUPAC Name | (E)-N-[2-oxo-2-[2-[4-[(5-phenyltetrazol-2-yl)methyl]benzoyl]hydrazinyl]ethyl]-3-phenylprop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1)NCC(=O)NNC(=O)c1ccc(Cn2nnc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C26H23N7O3/c34-23(16-13-19-7-3-1-4-8-19)27-17-24(35)28-30-26(36)22-14-11-20(12-15-22)18-33-31-25(29-32-33)21-9-5-2-6-10-21/h1-16H,17-18H2,(H,27,34)(H,28,35)(H,30,36)/b16-13+ |
| InChIKey | OMVMRDRGDQLLAX-DTQAZKPQSA-N |
| XLogP | 1.98 |
| TPSA | 130.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.52 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|