C24H21ClN6O2S — CID 27709841
N'-[2-[(4-chlorophenyl)methylsulfanyl]acetyl]-4-[(5-phenyltetrazol-2-yl)methyl]benzohydrazide (PubChem CID 27709841) has the molecular formula C24H21ClN6O2S and a molecular weight of 492.99 g/mol. Its IUPAC name is N'-[2-[(4-chlorophenyl)methylsulfanyl]acetyl]-4-[(5-phenyltetrazol-2-yl)methyl]benzohydrazide.
| Compound Name | N'-[2-[(4-chlorophenyl)methylsulfanyl]acetyl]-4-[(5-phenyltetrazol-2-yl)methyl]benzohydrazide |
|---|---|
| PubChem CID | 27709841 |
| Molecular Formula | C24H21ClN6O2S |
| Molecular Weight | 492.99 g/mol |
| Exact Mass | 492.11 |
| IUPAC Name | N'-[2-[(4-chlorophenyl)methylsulfanyl]acetyl]-4-[(5-phenyltetrazol-2-yl)methyl]benzohydrazide |
| SMILES | O=C(CSCc1ccc(Cl)cc1)NNC(=O)c1ccc(Cn2nnc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C24H21ClN6O2S/c25-21-12-8-18(9-13-21)15-34-16-22(32)26-28-24(33)20-10-6-17(7-11-20)14-31-29-23(27-30-31)19-4-2-1-3-5-19/h1-13H,14-16H2,(H,26,32)(H,28,33) |
| InChIKey | IUIFZTLRDOJQDA-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.99 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|