C27H26N6O3 — CID 24541975
N'-[4-(2,5-dimethylphenyl)-4-oxobutanoyl]-4-[(5-phenyltetrazol-2-yl)methyl]benzohydrazide (PubChem CID 24541975) has the molecular formula C27H26N6O3 and a molecular weight of 482.54 g/mol. Its IUPAC name is N'-[4-(2,5-dimethylphenyl)-4-oxobutanoyl]-4-[(5-phenyltetrazol-2-yl)methyl]benzohydrazide.
| Compound Name | N'-[4-(2,5-dimethylphenyl)-4-oxobutanoyl]-4-[(5-phenyltetrazol-2-yl)methyl]benzohydrazide |
|---|---|
| PubChem CID | 24541975 |
| Molecular Formula | C27H26N6O3 |
| Molecular Weight | 482.54 g/mol |
| Exact Mass | 482.21 |
| IUPAC Name | N'-[4-(2,5-dimethylphenyl)-4-oxobutanoyl]-4-[(5-phenyltetrazol-2-yl)methyl]benzohydrazide |
| SMILES | Cc1ccc(C)c(C(=O)CCC(=O)NNC(=O)c2ccc(Cn3nnc(-c4ccccc4)n3)cc2)c1 |
| InChI | InChI=1S/C27H26N6O3/c1-18-8-9-19(2)23(16-18)24(34)14-15-25(35)28-30-27(36)22-12-10-20(11-13-22)17-33-31-26(29-32-33)21-6-4-3-5-7-21/h3-13,16H,14-15,17H2,1-2H3,(H,28,35)(H,30,36) |
| InChIKey | QEOCSSHINBWQMJ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 118.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.54 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|