C22H16Cl2N6O2 — CID 24541848
2,3-dichloro-N'-[4-[(5-phenyltetrazol-2-yl)methyl]benzoyl]benzohydrazide (PubChem CID 24541848) has the molecular formula C22H16Cl2N6O2 and a molecular weight of 467.32 g/mol. Its IUPAC name is 2,3-dichloro-N'-[4-[(5-phenyltetrazol-2-yl)methyl]benzoyl]benzohydrazide.
| Compound Name | 2,3-dichloro-N'-[4-[(5-phenyltetrazol-2-yl)methyl]benzoyl]benzohydrazide |
|---|---|
| PubChem CID | 24541848 |
| Molecular Formula | C22H16Cl2N6O2 |
| Molecular Weight | 467.32 g/mol |
| Exact Mass | 466.07 |
| IUPAC Name | 2,3-dichloro-N'-[4-[(5-phenyltetrazol-2-yl)methyl]benzoyl]benzohydrazide |
| SMILES | O=C(NNC(=O)c1cccc(Cl)c1Cl)c1ccc(Cn2nnc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C22H16Cl2N6O2/c23-18-8-4-7-17(19(18)24)22(32)27-26-21(31)16-11-9-14(10-12-16)13-30-28-20(25-29-30)15-5-2-1-3-6-15/h1-12H,13H2,(H,26,31)(H,27,32) |
| InChIKey | HZDTVUZPDBJTJK-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.32 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|