C24H19N9O2 — CID 24541902
2-phenyl-N'-[4-[(5-phenyltetrazol-2-yl)methyl]benzoyl]triazole-4-carbohydrazide (PubChem CID 24541902) has the molecular formula C24H19N9O2 and a molecular weight of 465.48 g/mol. Its IUPAC name is 2-phenyl-N'-[4-[(5-phenyltetrazol-2-yl)methyl]benzoyl]triazole-4-carbohydrazide.
| Compound Name | 2-phenyl-N'-[4-[(5-phenyltetrazol-2-yl)methyl]benzoyl]triazole-4-carbohydrazide |
|---|---|
| PubChem CID | 24541902 |
| Molecular Formula | C24H19N9O2 |
| Molecular Weight | 465.48 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | 2-phenyl-N'-[4-[(5-phenyltetrazol-2-yl)methyl]benzoyl]triazole-4-carbohydrazide |
| SMILES | O=C(NNC(=O)c1cnn(-c2ccccc2)n1)c1ccc(Cn2nnc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C24H19N9O2/c34-23(27-28-24(35)21-15-25-33(29-21)20-9-5-2-6-10-20)19-13-11-17(12-14-19)16-32-30-22(26-31-32)18-7-3-1-4-8-18/h1-15H,16H2,(H,27,34)(H,28,35) |
| InChIKey | QUPVUVQMMVRRBC-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 132.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.48 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|