C25H23ClN6O2 — CID 24586128
N'-[3-(3-chloro-4-methylphenyl)propanoyl]-4-[(5-phenyltetrazol-2-yl)methyl]benzohydrazide (PubChem CID 24586128) has the molecular formula C25H23ClN6O2 and a molecular weight of 474.95 g/mol. Its IUPAC name is N'-[3-(3-chloro-4-methylphenyl)propanoyl]-4-[(5-phenyltetrazol-2-yl)methyl]benzohydrazide.
| Compound Name | N'-[3-(3-chloro-4-methylphenyl)propanoyl]-4-[(5-phenyltetrazol-2-yl)methyl]benzohydrazide |
|---|---|
| PubChem CID | 24586128 |
| Molecular Formula | C25H23ClN6O2 |
| Molecular Weight | 474.95 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | N'-[3-(3-chloro-4-methylphenyl)propanoyl]-4-[(5-phenyltetrazol-2-yl)methyl]benzohydrazide |
| SMILES | Cc1ccc(CCC(=O)NNC(=O)c2ccc(Cn3nnc(-c4ccccc4)n3)cc2)cc1Cl |
| InChI | InChI=1S/C25H23ClN6O2/c1-17-7-8-18(15-22(17)26)11-14-23(33)27-29-25(34)21-12-9-19(10-13-21)16-32-30-24(28-31-32)20-5-3-2-4-6-20/h2-10,12-13,15H,11,14,16H2,1H3,(H,27,33)(H,29,34) |
| InChIKey | JPAUYKDSPULTFV-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.95 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|