C23H23N7O3 — CID 35853173
3-methyl-N'-[4-[(5-phenyltetrazol-2-yl)methyl]benzoyl]-5-propan-2-yl-1,2-oxazole-4-carbohydrazide (PubChem CID 35853173) has the molecular formula C23H23N7O3 and a molecular weight of 445.48 g/mol. Its IUPAC name is 3-methyl-N'-[4-[(5-phenyltetrazol-2-yl)methyl]benzoyl]-5-propan-2-yl-1,2-oxazole-4-carbohydrazide.
| Compound Name | 3-methyl-N'-[4-[(5-phenyltetrazol-2-yl)methyl]benzoyl]-5-propan-2-yl-1,2-oxazole-4-carbohydrazide |
|---|---|
| PubChem CID | 35853173 |
| Molecular Formula | C23H23N7O3 |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | 3-methyl-N'-[4-[(5-phenyltetrazol-2-yl)methyl]benzoyl]-5-propan-2-yl-1,2-oxazole-4-carbohydrazide |
| SMILES | Cc1noc(C(C)C)c1C(=O)NNC(=O)c1ccc(Cn2nnc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C23H23N7O3/c1-14(2)20-19(15(3)28-33-20)23(32)26-25-22(31)18-11-9-16(10-12-18)13-30-27-21(24-29-30)17-7-5-4-6-8-17/h4-12,14H,13H2,1-3H3,(H,25,31)(H,26,32) |
| InChIKey | UIRAUTHUSRYLJJ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 127.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|