C22H16N6O3 — CID 30878164
N'-(2-benzo[e][1]benzofuran-1-ylacetyl)-4-(tetrazol-1-yl)benzohydrazide (PubChem CID 30878164) has the molecular formula C22H16N6O3 and a molecular weight of 412.41 g/mol. Its IUPAC name is N'-(2-benzo[e][1]benzofuran-1-ylacetyl)-4-(tetrazol-1-yl)benzohydrazide.
| Compound Name | N'-(2-benzo[e][1]benzofuran-1-ylacetyl)-4-(tetrazol-1-yl)benzohydrazide |
|---|---|
| PubChem CID | 30878164 |
| Molecular Formula | C22H16N6O3 |
| Molecular Weight | 412.41 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | N'-(2-benzo[e][1]benzofuran-1-ylacetyl)-4-(tetrazol-1-yl)benzohydrazide |
| SMILES | O=C(Cc1coc2ccc3ccccc3c12)NNC(=O)c1ccc(-n2cnnn2)cc1 |
| InChI | InChI=1S/C22H16N6O3/c29-20(11-16-12-31-19-10-7-14-3-1-2-4-18(14)21(16)19)24-25-22(30)15-5-8-17(9-6-15)28-13-23-26-27-28/h1-10,12-13H,11H2,(H,24,29)(H,25,30) |
| InChIKey | YZNOAGQPGVLOMT-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 114.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.41 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|