C26H28N2O3 — CID 5132781
N'-[2-(1-adamantyl)acetyl]-2-benzo[e][1]benzofuran-1-ylacetohydrazide (PubChem CID 5132781) has the molecular formula C26H28N2O3 and a molecular weight of 416.52 g/mol. Its IUPAC name is N'-[2-(1-adamantyl)acetyl]-2-benzo[e][1]benzofuran-1-ylacetohydrazide.
| Compound Name | N'-[2-(1-adamantyl)acetyl]-2-benzo[e][1]benzofuran-1-ylacetohydrazide |
|---|---|
| PubChem CID | 5132781 |
| Molecular Formula | C26H28N2O3 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | N'-[2-(1-adamantyl)acetyl]-2-benzo[e][1]benzofuran-1-ylacetohydrazide |
| SMILES | O=C(Cc1coc2ccc3ccccc3c12)NNC(=O)CC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C26H28N2O3/c29-23(10-20-15-31-22-6-5-19-3-1-2-4-21(19)25(20)22)27-28-24(30)14-26-11-16-7-17(12-26)9-18(8-16)13-26/h1-6,15-18H,7-14H2,(H,27,29)(H,28,30) |
| InChIKey | LVVQFRMXZCVOKI-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|