C19H19NO3 — CID 7964651
2-benzo[e][1]benzofuran-1-yl-N-[[(2S)-oxolan-2-yl]methyl]acetamide (PubChem CID 7964651) has the molecular formula C19H19NO3 and a molecular weight of 309.36 g/mol. Its IUPAC name is 2-benzo[e][1]benzofuran-1-yl-N-[[(2S)-oxolan-2-yl]methyl]acetamide.
| Compound Name | 2-benzo[e][1]benzofuran-1-yl-N-[[(2S)-oxolan-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 7964651 |
| Molecular Formula | C19H19NO3 |
| Molecular Weight | 309.36 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | 2-benzo[e][1]benzofuran-1-yl-N-[[(2S)-oxolan-2-yl]methyl]acetamide |
| SMILES | O=C(Cc1coc2ccc3ccccc3c12)NC[C@@H]1CCCO1 |
| InChI | InChI=1S/C19H19NO3/c21-18(20-11-15-5-3-9-22-15)10-14-12-23-17-8-7-13-4-1-2-6-16(13)19(14)17/h1-2,4,6-8,12,15H,3,5,9-11H2,(H,20,21)/t15-/m0/s1 |
| InChIKey | NOPOTUDYAVAYIC-HNNXBMFYSA-N |
| XLogP | 3.42 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.36 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |