C22H18N2O3 — CID 4728287
N'-(2-benzo[e][1]benzofuran-1-ylacetyl)-2-methylbenzohydrazide (PubChem CID 4728287) has the molecular formula C22H18N2O3 and a molecular weight of 358.40 g/mol. Its IUPAC name is N'-(2-benzo[e][1]benzofuran-1-ylacetyl)-2-methylbenzohydrazide.
| Compound Name | N'-(2-benzo[e][1]benzofuran-1-ylacetyl)-2-methylbenzohydrazide |
|---|---|
| PubChem CID | 4728287 |
| Molecular Formula | C22H18N2O3 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | N'-(2-benzo[e][1]benzofuran-1-ylacetyl)-2-methylbenzohydrazide |
| SMILES | Cc1ccccc1C(=O)NNC(=O)Cc1coc2ccc3ccccc3c12 |
| InChI | InChI=1S/C22H18N2O3/c1-14-6-2-4-8-17(14)22(26)24-23-20(25)12-16-13-27-19-11-10-15-7-3-5-9-18(15)21(16)19/h2-11,13H,12H2,1H3,(H,23,25)(H,24,26) |
| InChIKey | MJHXHTVCCIAIFB-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|