C21H17N3O4 — CID 9077912
2-benzo[e][1]benzofuran-1-yl-N'-[2-(2-oxo-1-pyridinyl)acetyl]acetohydrazide (PubChem CID 9077912) has the molecular formula C21H17N3O4 and a molecular weight of 375.38 g/mol. Its IUPAC name is 2-benzo[e][1]benzofuran-1-yl-N'-[2-(2-oxo-1-pyridinyl)acetyl]acetohydrazide.
| Compound Name | 2-benzo[e][1]benzofuran-1-yl-N'-[2-(2-oxo-1-pyridinyl)acetyl]acetohydrazide |
|---|---|
| PubChem CID | 9077912 |
| Molecular Formula | C21H17N3O4 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | 2-benzo[e][1]benzofuran-1-yl-N'-[2-(2-oxo-1-pyridinyl)acetyl]acetohydrazide |
| SMILES | O=C(Cc1coc2ccc3ccccc3c12)NNC(=O)Cn1ccccc1=O |
| InChI | InChI=1S/C21H17N3O4/c25-18(22-23-19(26)12-24-10-4-3-7-20(24)27)11-15-13-28-17-9-8-14-5-1-2-6-16(14)21(15)17/h1-10,13H,11-12H2,(H,22,25)(H,23,26) |
| InChIKey | VZMTVDIFAHKQJR-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 93.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|