C23H19FN2O4 — CID 7964952
(2S)-N'-(2-benzo[e][1]benzofuran-1-ylacetyl)-2-(4-fluorophenoxy)propanehydrazide (PubChem CID 7964952) has the molecular formula C23H19FN2O4 and a molecular weight of 406.41 g/mol. Its IUPAC name is (2S)-N'-(2-benzo[e][1]benzofuran-1-ylacetyl)-2-(4-fluorophenoxy)propanehydrazide.
| Compound Name | (2S)-N'-(2-benzo[e][1]benzofuran-1-ylacetyl)-2-(4-fluorophenoxy)propanehydrazide |
|---|---|
| PubChem CID | 7964952 |
| Molecular Formula | C23H19FN2O4 |
| Molecular Weight | 406.41 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | (2S)-N'-(2-benzo[e][1]benzofuran-1-ylacetyl)-2-(4-fluorophenoxy)propanehydrazide |
| SMILES | C[C@H](Oc1ccc(F)cc1)C(=O)NNC(=O)Cc1coc2ccc3ccccc3c12 |
| InChI | InChI=1S/C23H19FN2O4/c1-14(30-18-9-7-17(24)8-10-18)23(28)26-25-21(27)12-16-13-29-20-11-6-15-4-2-3-5-19(15)22(16)20/h2-11,13-14H,12H2,1H3,(H,25,27)(H,26,28)/t14-/m0/s1 |
| InChIKey | AQRQAXIJVIVYQL-AWEZNQCLSA-N |
| XLogP | 3.88 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.41 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|