C22H17F2NO2 — CID 18112615
2-benzo[e][1]benzofuran-1-yl-N-[1-(3,4-difluorophenyl)ethyl]acetamide (PubChem CID 18112615) has the molecular formula C22H17F2NO2 and a molecular weight of 365.38 g/mol. Its IUPAC name is 2-benzo[e][1]benzofuran-1-yl-N-[1-(3,4-difluorophenyl)ethyl]acetamide.
| Compound Name | 2-benzo[e][1]benzofuran-1-yl-N-[1-(3,4-difluorophenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 18112615 |
| Molecular Formula | C22H17F2NO2 |
| Molecular Weight | 365.38 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | 2-benzo[e][1]benzofuran-1-yl-N-[1-(3,4-difluorophenyl)ethyl]acetamide |
| SMILES | CC(NC(=O)Cc1coc2ccc3ccccc3c12)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C22H17F2NO2/c1-13(15-6-8-18(23)19(24)10-15)25-21(26)11-16-12-27-20-9-7-14-4-2-3-5-17(14)22(16)20/h2-10,12-13H,11H2,1H3,(H,25,26) |
| InChIKey | HLTGYQWTHIOYRZ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.38 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |