C22H17ClN6O3 — CID 30882374
2-[(4-chlorophenyl)methoxy]-N'-[4-(tetrazol-1-yl)benzoyl]benzohydrazide (PubChem CID 30882374) has the molecular formula C22H17ClN6O3 and a molecular weight of 448.87 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methoxy]-N'-[4-(tetrazol-1-yl)benzoyl]benzohydrazide.
| Compound Name | 2-[(4-chlorophenyl)methoxy]-N'-[4-(tetrazol-1-yl)benzoyl]benzohydrazide |
|---|---|
| PubChem CID | 30882374 |
| Molecular Formula | C22H17ClN6O3 |
| Molecular Weight | 448.87 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | 2-[(4-chlorophenyl)methoxy]-N'-[4-(tetrazol-1-yl)benzoyl]benzohydrazide |
| SMILES | O=C(NNC(=O)c1ccccc1OCc1ccc(Cl)cc1)c1ccc(-n2cnnn2)cc1 |
| InChI | InChI=1S/C22H17ClN6O3/c23-17-9-5-15(6-10-17)13-32-20-4-2-1-3-19(20)22(31)26-25-21(30)16-7-11-18(12-8-16)29-14-24-27-28-29/h1-12,14H,13H2,(H,25,30)(H,26,31) |
| InChIKey | FASSVWRCFRWFEU-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 111.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.87 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|