C17H13N7O2S2 — CID 46636660
4-(tetrazol-1-yl)-N'-[2-(2-thiophen-3-yl-1,3-thiazol-4-yl)acetyl]benzohydrazide (PubChem CID 46636660) has the molecular formula C17H13N7O2S2 and a molecular weight of 411.47 g/mol. Its IUPAC name is 4-(tetrazol-1-yl)-N'-[2-(2-thiophen-3-yl-1,3-thiazol-4-yl)acetyl]benzohydrazide.
| Compound Name | 4-(tetrazol-1-yl)-N'-[2-(2-thiophen-3-yl-1,3-thiazol-4-yl)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 46636660 |
| Molecular Formula | C17H13N7O2S2 |
| Molecular Weight | 411.47 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | 4-(tetrazol-1-yl)-N'-[2-(2-thiophen-3-yl-1,3-thiazol-4-yl)acetyl]benzohydrazide |
| SMILES | O=C(Cc1csc(-c2ccsc2)n1)NNC(=O)c1ccc(-n2cnnn2)cc1 |
| InChI | InChI=1S/C17H13N7O2S2/c25-15(7-13-9-28-17(19-13)12-5-6-27-8-12)20-21-16(26)11-1-3-14(4-2-11)24-10-18-22-23-24/h1-6,8-10H,7H2,(H,20,25)(H,21,26) |
| InChIKey | XUGILPVUURXPKI-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 114.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.47 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|