C20H17N5O2S — CID 9455557
[2-(4-ethylphenyl)-1,3-thiazol-4-yl]methyl 4-(tetrazol-1-yl)benzoate (PubChem CID 9455557) has the molecular formula C20H17N5O2S and a molecular weight of 391.46 g/mol. Its IUPAC name is [2-(4-ethylphenyl)-1,3-thiazol-4-yl]methyl 4-(tetrazol-1-yl)benzoate.
| Compound Name | [2-(4-ethylphenyl)-1,3-thiazol-4-yl]methyl 4-(tetrazol-1-yl)benzoate |
|---|---|
| PubChem CID | 9455557 |
| Molecular Formula | C20H17N5O2S |
| Molecular Weight | 391.46 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | [2-(4-ethylphenyl)-1,3-thiazol-4-yl]methyl 4-(tetrazol-1-yl)benzoate |
| SMILES | CCc1ccc(-c2nc(COC(=O)c3ccc(-n4cnnn4)cc3)cs2)cc1 |
| InChI | InChI=1S/C20H17N5O2S/c1-2-14-3-5-15(6-4-14)19-22-17(12-28-19)11-27-20(26)16-7-9-18(10-8-16)25-13-21-23-24-25/h3-10,12-13H,2,11H2,1H3 |
| InChIKey | MNFTVMHQDIDADS-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 82.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.46 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |