C16H11N5O3S — CID 55514433
[2-(furan-2-yl)-1,3-thiazol-4-yl]methyl 3-(tetrazol-1-yl)benzoate (PubChem CID 55514433) has the molecular formula C16H11N5O3S and a molecular weight of 353.36 g/mol. Its IUPAC name is [2-(furan-2-yl)-1,3-thiazol-4-yl]methyl 3-(tetrazol-1-yl)benzoate.
| Compound Name | [2-(furan-2-yl)-1,3-thiazol-4-yl]methyl 3-(tetrazol-1-yl)benzoate |
|---|---|
| PubChem CID | 55514433 |
| Molecular Formula | C16H11N5O3S |
| Molecular Weight | 353.36 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | [2-(furan-2-yl)-1,3-thiazol-4-yl]methyl 3-(tetrazol-1-yl)benzoate |
| SMILES | O=C(OCc1csc(-c2ccco2)n1)c1cccc(-n2cnnn2)c1 |
| InChI | InChI=1S/C16H11N5O3S/c22-16(11-3-1-4-13(7-11)21-10-17-19-20-21)24-8-12-9-25-15(18-12)14-5-2-6-23-14/h1-7,9-10H,8H2 |
| InChIKey | WCEJSBNZTBHKDG-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 95.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.36 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |