C16H14N2O6S2 — CID 32757862
[2-(furan-2-yl)-1,3-thiazol-4-yl]methyl 4-methoxy-3-sulfamoylbenzoate (PubChem CID 32757862) has the molecular formula C16H14N2O6S2 and a molecular weight of 394.43 g/mol. Its IUPAC name is [2-(furan-2-yl)-1,3-thiazol-4-yl]methyl 4-methoxy-3-sulfamoylbenzoate.
| Compound Name | [2-(furan-2-yl)-1,3-thiazol-4-yl]methyl 4-methoxy-3-sulfamoylbenzoate |
|---|---|
| PubChem CID | 32757862 |
| Molecular Formula | C16H14N2O6S2 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.03 |
| IUPAC Name | [2-(furan-2-yl)-1,3-thiazol-4-yl]methyl 4-methoxy-3-sulfamoylbenzoate |
| SMILES | COc1ccc(C(=O)OCc2csc(-c3ccco3)n2)cc1S(N)(=O)=O |
| InChI | InChI=1S/C16H14N2O6S2/c1-22-12-5-4-10(7-14(12)26(17,20)21)16(19)24-8-11-9-25-15(18-11)13-3-2-6-23-13/h2-7,9H,8H2,1H3,(H2,17,20,21) |
| InChIKey | DORIPBXJEBBFAC-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 121.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |