C19H15F2NO2S — CID 40747613
[2-(4-ethylphenyl)-1,3-thiazol-4-yl]methyl 2,6-difluorobenzoate (PubChem CID 40747613) has the molecular formula C19H15F2NO2S and a molecular weight of 359.40 g/mol. Its IUPAC name is [2-(4-ethylphenyl)-1,3-thiazol-4-yl]methyl 2,6-difluorobenzoate.
| Compound Name | [2-(4-ethylphenyl)-1,3-thiazol-4-yl]methyl 2,6-difluorobenzoate |
|---|---|
| PubChem CID | 40747613 |
| Molecular Formula | C19H15F2NO2S |
| Molecular Weight | 359.40 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | [2-(4-ethylphenyl)-1,3-thiazol-4-yl]methyl 2,6-difluorobenzoate |
| SMILES | CCc1ccc(-c2nc(COC(=O)c3c(F)cccc3F)cs2)cc1 |
| InChI | InChI=1S/C19H15F2NO2S/c1-2-12-6-8-13(9-7-12)18-22-14(11-25-18)10-24-19(23)17-15(20)4-3-5-16(17)21/h3-9,11H,2,10H2,1H3 |
| InChIKey | YQXPGXDOKJPHRK-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.40 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |