C16H12N4O4 — CID 7500782
1,3-benzodioxol-5-ylmethyl 4-(tetrazol-1-yl)benzoate (PubChem CID 7500782) has the molecular formula C16H12N4O4 and a molecular weight of 324.30 g/mol. Its IUPAC name is 1,3-benzodioxol-5-ylmethyl 4-(tetrazol-1-yl)benzoate.
| Compound Name | 1,3-benzodioxol-5-ylmethyl 4-(tetrazol-1-yl)benzoate |
|---|---|
| PubChem CID | 7500782 |
| Molecular Formula | C16H12N4O4 |
| Molecular Weight | 324.30 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | 1,3-benzodioxol-5-ylmethyl 4-(tetrazol-1-yl)benzoate |
| SMILES | O=C(OCc1ccc2c(c1)OCO2)c1ccc(-n2cnnn2)cc1 |
| InChI | InChI=1S/C16H12N4O4/c21-16(12-2-4-13(5-3-12)20-9-17-18-19-20)22-8-11-1-6-14-15(7-11)24-10-23-14/h1-7,9H,8,10H2 |
| InChIKey | XWAZRDLIMFLYKP-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 88.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.30 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |