C20H16ClN3O3 — CID 101082700
4-chloro-N-[[(2-naphthalen-2-ylacetyl)amino]carbamoyl]benzamide (PubChem CID 101082700) has the molecular formula C20H16ClN3O3 and a molecular weight of 381.82 g/mol. Its IUPAC name is 4-chloro-N-[[(2-naphthalen-2-ylacetyl)amino]carbamoyl]benzamide.
| Compound Name | 4-chloro-N-[[(2-naphthalen-2-ylacetyl)amino]carbamoyl]benzamide |
|---|---|
| PubChem CID | 101082700 |
| Molecular Formula | C20H16ClN3O3 |
| Molecular Weight | 381.82 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | 4-chloro-N-[[(2-naphthalen-2-ylacetyl)amino]carbamoyl]benzamide |
| SMILES | O=C(Cc1ccc2ccccc2c1)NNC(=O)NC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H16ClN3O3/c21-17-9-7-15(8-10-17)19(26)22-20(27)24-23-18(25)12-13-5-6-14-3-1-2-4-16(14)11-13/h1-11H,12H2,(H,23,25)(H2,22,24,26,27) |
| InChIKey | HSCARTQRAODGGD-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.82 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|