C15H14F3N3O3S — CID 3072238
N-[2-(methanesulfonamido)-5-(trifluoromethyl)-3-pyridinyl]-3-methylbenzamide (PubChem CID 3072238) has the molecular formula C15H14F3N3O3S and a molecular weight of 373.36 g/mol. Its IUPAC name is N-[2-(methanesulfonamido)-5-(trifluoromethyl)-3-pyridinyl]-3-methylbenzamide.
| Compound Name | N-[2-(methanesulfonamido)-5-(trifluoromethyl)-3-pyridinyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 3072238 |
| Molecular Formula | C15H14F3N3O3S |
| Molecular Weight | 373.36 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | N-[2-(methanesulfonamido)-5-(trifluoromethyl)-3-pyridinyl]-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)Nc2cc(C(F)(F)F)cnc2NS(C)(=O)=O)c1 |
| InChI | InChI=1S/C15H14F3N3O3S/c1-9-4-3-5-10(6-9)14(22)20-12-7-11(15(16,17)18)8-19-13(12)21-25(2,23)24/h3-8H,1-2H3,(H,19,21)(H,20,22) |
| InChIKey | LNXFRJRPKNNENM-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.36 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |