C13H10F3N3O3S — CID 171502365
N-[2-methylsulfonyl-5-(trifluoromethyl)-3-pyridinyl]pyridine-3-carboxamide (PubChem CID 171502365) has the molecular formula C13H10F3N3O3S and a molecular weight of 345.30 g/mol. Its IUPAC name is N-[2-methylsulfonyl-5-(trifluoromethyl)-3-pyridinyl]pyridine-3-carboxamide.
| Compound Name | N-[2-methylsulfonyl-5-(trifluoromethyl)-3-pyridinyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 171502365 |
| Molecular Formula | C13H10F3N3O3S |
| Molecular Weight | 345.30 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | N-[2-methylsulfonyl-5-(trifluoromethyl)-3-pyridinyl]pyridine-3-carboxamide |
| SMILES | CS(=O)(=O)c1ncc(C(F)(F)F)cc1NC(=O)c1cccnc1 |
| InChI | InChI=1S/C13H10F3N3O3S/c1-23(21,22)12-10(5-9(7-18-12)13(14,15)16)19-11(20)8-3-2-4-17-6-8/h2-7H,1H3,(H,19,20) |
| InChIKey | RPGXZPOPZSZPRU-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.30 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |