C13H12Cl2F3N3O — CID 3042222
N-[2-amino-5-(trifluoromethyl)phenyl]pyridine-3-carboxamide;dihydrochloride (PubChem CID 3042222) has the molecular formula C13H12Cl2F3N3O and a molecular weight of 354.16 g/mol. Its IUPAC name is N-[2-amino-5-(trifluoromethyl)phenyl]pyridine-3-carboxamide;dihydrochloride.
| Compound Name | N-[2-amino-5-(trifluoromethyl)phenyl]pyridine-3-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 3042222 |
| Molecular Formula | C13H12Cl2F3N3O |
| Molecular Weight | 354.16 g/mol |
| Exact Mass | 353.03 |
| IUPAC Name | N-[2-amino-5-(trifluoromethyl)phenyl]pyridine-3-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.Nc1ccc(C(F)(F)F)cc1NC(=O)c1cccnc1 |
| InChI | InChI=1S/C13H10F3N3O.2ClH/c14-13(15,16)9-3-4-10(17)11(6-9)19-12(20)8-2-1-5-18-7-8;;/h1-7H,17H2,(H,19,20);2*1H |
| InChIKey | WTTHDCQULQWLBP-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.16 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|