C13H13Cl2N3O3 — CID 75415042
N-(6-amino-1,3-benzodioxol-5-yl)pyridine-3-carboxamide;dihydrochloride (PubChem CID 75415042) has the molecular formula C13H13Cl2N3O3 and a molecular weight of 330.17 g/mol. Its IUPAC name is N-(6-amino-1,3-benzodioxol-5-yl)pyridine-3-carboxamide;dihydrochloride.
| Compound Name | N-(6-amino-1,3-benzodioxol-5-yl)pyridine-3-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 75415042 |
| Molecular Formula | C13H13Cl2N3O3 |
| Molecular Weight | 330.17 g/mol |
| Exact Mass | 329.03 |
| IUPAC Name | N-(6-amino-1,3-benzodioxol-5-yl)pyridine-3-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.Nc1cc2c(cc1NC(=O)c1cccnc1)OCO2 |
| InChI | InChI=1S/C13H11N3O3.2ClH/c14-9-4-11-12(19-7-18-11)5-10(9)16-13(17)8-2-1-3-15-6-8;;/h1-6H,7,14H2,(H,16,17);2*1H |
| InChIKey | UPYZFCRVSFKUHX-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.17 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|