C13H10FN3O3 — CID 104638032
N-(6-amino-1,3-benzodioxol-5-yl)-5-fluoropyridine-2-carboxamide (PubChem CID 104638032) has the molecular formula C13H10FN3O3 and a molecular weight of 275.24 g/mol. Its IUPAC name is N-(6-amino-1,3-benzodioxol-5-yl)-5-fluoropyridine-2-carboxamide.
| Compound Name | N-(6-amino-1,3-benzodioxol-5-yl)-5-fluoropyridine-2-carboxamide |
|---|---|
| PubChem CID | 104638032 |
| Molecular Formula | C13H10FN3O3 |
| Molecular Weight | 275.24 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | N-(6-amino-1,3-benzodioxol-5-yl)-5-fluoropyridine-2-carboxamide |
| SMILES | Nc1cc2c(cc1NC(=O)c1ccc(F)cn1)OCO2 |
| InChI | InChI=1S/C13H10FN3O3/c14-7-1-2-9(16-5-7)13(18)17-10-4-12-11(3-8(10)15)19-6-20-12/h1-5H,6,15H2,(H,17,18) |
| InChIKey | IIBYXQDNBNUSJG-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.24 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|