C14H17Cl2N3O3S — CID 119619097
N-(6-amino-1,3-benzodioxol-5-yl)-2-propyl-1,3-thiazole-5-carboxamide;dihydrochloride (PubChem CID 119619097) has the molecular formula C14H17Cl2N3O3S and a molecular weight of 378.28 g/mol. Its IUPAC name is N-(6-amino-1,3-benzodioxol-5-yl)-2-propyl-1,3-thiazole-5-carboxamide;dihydrochloride.
| Compound Name | N-(6-amino-1,3-benzodioxol-5-yl)-2-propyl-1,3-thiazole-5-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119619097 |
| Molecular Formula | C14H17Cl2N3O3S |
| Molecular Weight | 378.28 g/mol |
| Exact Mass | 377.04 |
| IUPAC Name | N-(6-amino-1,3-benzodioxol-5-yl)-2-propyl-1,3-thiazole-5-carboxamide;dihydrochloride |
| SMILES | CCCc1ncc(C(=O)Nc2cc3c(cc2N)OCO3)s1.Cl.Cl |
| InChI | InChI=1S/C14H15N3O3S.2ClH/c1-2-3-13-16-6-12(21-13)14(18)17-9-5-11-10(4-8(9)15)19-7-20-11;;/h4-6H,2-3,7,15H2,1H3,(H,17,18);2*1H |
| InChIKey | XSXRLYUMCJEANT-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.28 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|