C14H16N4O3 — CID 66122267
N-(6-amino-1,3-benzodioxol-5-yl)-3-ethyl-1-methylpyrazole-5-carboxamide (PubChem CID 66122267) has the molecular formula C14H16N4O3 and a molecular weight of 288.31 g/mol. Its IUPAC name is N-(6-amino-1,3-benzodioxol-5-yl)-3-ethyl-1-methylpyrazole-5-carboxamide.
| Compound Name | N-(6-amino-1,3-benzodioxol-5-yl)-3-ethyl-1-methylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 66122267 |
| Molecular Formula | C14H16N4O3 |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | N-(6-amino-1,3-benzodioxol-5-yl)-3-ethyl-1-methylpyrazole-5-carboxamide |
| SMILES | CCc1cc(C(=O)Nc2cc3c(cc2N)OCO3)n(C)n1 |
| InChI | InChI=1S/C14H16N4O3/c1-3-8-4-11(18(2)17-8)14(19)16-10-6-13-12(5-9(10)15)20-7-21-13/h4-6H,3,7,15H2,1-2H3,(H,16,19) |
| InChIKey | OGWMPCDNCGETLE-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|