C14H16N4O3 — CID 66121495
3-amino-4-[(3-ethyl-1-methylpyrazole-5-carbonyl)amino]benzoic acid (PubChem CID 66121495) has the molecular formula C14H16N4O3 and a molecular weight of 288.31 g/mol. Its IUPAC name is 3-amino-4-[(3-ethyl-1-methylpyrazole-5-carbonyl)amino]benzoic acid.
| Compound Name | 3-amino-4-[(3-ethyl-1-methylpyrazole-5-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 66121495 |
| Molecular Formula | C14H16N4O3 |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | 3-amino-4-[(3-ethyl-1-methylpyrazole-5-carbonyl)amino]benzoic acid |
| SMILES | CCc1cc(C(=O)Nc2ccc(C(=O)O)cc2N)n(C)n1 |
| InChI | InChI=1S/C14H16N4O3/c1-3-9-7-12(18(2)17-9)13(19)16-11-5-4-8(14(20)21)6-10(11)15/h4-7H,3,15H2,1-2H3,(H,16,19)(H,20,21) |
| InChIKey | WADRNHCACUUWJX-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|