C14H16BrN3O — CID 66121522
N-(4-bromo-2-methylphenyl)-3-ethyl-1-methylpyrazole-5-carboxamide (PubChem CID 66121522) has the molecular formula C14H16BrN3O and a molecular weight of 322.21 g/mol. Its IUPAC name is N-(4-bromo-2-methylphenyl)-3-ethyl-1-methylpyrazole-5-carboxamide.
| Compound Name | N-(4-bromo-2-methylphenyl)-3-ethyl-1-methylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 66121522 |
| Molecular Formula | C14H16BrN3O |
| Molecular Weight | 322.21 g/mol |
| Exact Mass | 321.05 |
| IUPAC Name | N-(4-bromo-2-methylphenyl)-3-ethyl-1-methylpyrazole-5-carboxamide |
| SMILES | CCc1cc(C(=O)Nc2ccc(Br)cc2C)n(C)n1 |
| InChI | InChI=1S/C14H16BrN3O/c1-4-11-8-13(18(3)17-11)14(19)16-12-6-5-10(15)7-9(12)2/h5-8H,4H2,1-3H3,(H,16,19) |
| InChIKey | DCGYDHDQSAIOLF-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.21 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |