C11H15N3O3 — CID 79160086
3-(6-amino-1,3-benzodioxol-5-yl)-1-ethyl-1-methylurea (PubChem CID 79160086) has the molecular formula C11H15N3O3 and a molecular weight of 237.26 g/mol. Its IUPAC name is 3-(6-amino-1,3-benzodioxol-5-yl)-1-ethyl-1-methylurea.
| Compound Name | 3-(6-amino-1,3-benzodioxol-5-yl)-1-ethyl-1-methylurea |
|---|---|
| PubChem CID | 79160086 |
| Molecular Formula | C11H15N3O3 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | 3-(6-amino-1,3-benzodioxol-5-yl)-1-ethyl-1-methylurea |
| SMILES | CCN(C)C(=O)Nc1cc2c(cc1N)OCO2 |
| InChI | InChI=1S/C11H15N3O3/c1-3-14(2)11(15)13-8-5-10-9(4-7(8)12)16-6-17-10/h4-5H,3,6,12H2,1-2H3,(H,13,15) |
| InChIKey | CFIKXFROVAYYPM-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|