C11H14F3N3O — CID 79152321
3-[2-amino-4-(trifluoromethyl)phenyl]-1-ethyl-1-methylurea (PubChem CID 79152321) has the molecular formula C11H14F3N3O and a molecular weight of 261.25 g/mol. Its IUPAC name is 3-[2-amino-4-(trifluoromethyl)phenyl]-1-ethyl-1-methylurea.
| Compound Name | 3-[2-amino-4-(trifluoromethyl)phenyl]-1-ethyl-1-methylurea |
|---|---|
| PubChem CID | 79152321 |
| Molecular Formula | C11H14F3N3O |
| Molecular Weight | 261.25 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 3-[2-amino-4-(trifluoromethyl)phenyl]-1-ethyl-1-methylurea |
| SMILES | CCN(C)C(=O)Nc1ccc(C(F)(F)F)cc1N |
| InChI | InChI=1S/C11H14F3N3O/c1-3-17(2)10(18)16-9-5-4-7(6-8(9)15)11(12,13)14/h4-6H,3,15H2,1-2H3,(H,16,18) |
| InChIKey | CMJNDYXPHNINMW-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.25 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|