C10H9F3N2O3 — CID 110480197
3-[2-amino-4-(trifluoromethyl)anilino]-3-oxopropanoic acid (PubChem CID 110480197) has the molecular formula C10H9F3N2O3 and a molecular weight of 262.19 g/mol. Its IUPAC name is 3-[2-amino-4-(trifluoromethyl)anilino]-3-oxopropanoic acid.
| Compound Name | 3-[2-amino-4-(trifluoromethyl)anilino]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 110480197 |
| Molecular Formula | C10H9F3N2O3 |
| Molecular Weight | 262.19 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | 3-[2-amino-4-(trifluoromethyl)anilino]-3-oxopropanoic acid |
| SMILES | Nc1cc(C(F)(F)F)ccc1NC(=O)CC(=O)O |
| InChI | InChI=1S/C10H9F3N2O3/c11-10(12,13)5-1-2-7(6(14)3-5)15-8(16)4-9(17)18/h1-3H,4,14H2,(H,15,16)(H,17,18) |
| InChIKey | CYYYATYUQXXOJT-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.19 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|