C17H11ClF3NO5 — CID 21260376
3-[2-(5-chloro-2-hydroxybenzoyl)-4-(trifluoromethyl)anilino]-3-oxopropanoic acid (PubChem CID 21260376) has the molecular formula C17H11ClF3NO5 and a molecular weight of 401.72 g/mol. Its IUPAC name is 3-[2-(5-chloro-2-hydroxybenzoyl)-4-(trifluoromethyl)anilino]-3-oxopropanoic acid.
| Compound Name | 3-[2-(5-chloro-2-hydroxybenzoyl)-4-(trifluoromethyl)anilino]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 21260376 |
| Molecular Formula | C17H11ClF3NO5 |
| Molecular Weight | 401.72 g/mol |
| Exact Mass | 401.03 |
| IUPAC Name | 3-[2-(5-chloro-2-hydroxybenzoyl)-4-(trifluoromethyl)anilino]-3-oxopropanoic acid |
| SMILES | O=C(O)CC(=O)Nc1ccc(C(F)(F)F)cc1C(=O)c1cc(Cl)ccc1O |
| InChI | InChI=1S/C17H11ClF3NO5/c18-9-2-4-13(23)11(6-9)16(27)10-5-8(17(19,20)21)1-3-12(10)22-14(24)7-15(25)26/h1-6,23H,7H2,(H,22,24)(H,25,26) |
| InChIKey | YMHUMMAIHKYLMI-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.72 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|