C20H12Cl2F3NO2S2 — CID 141233852
5-chloro-N-[2-[(4-chlorophenyl)disulfanyl]-5-(trifluoromethyl)phenyl]-2-hydroxybenzamide (PubChem CID 141233852) has the molecular formula C20H12Cl2F3NO2S2 and a molecular weight of 490.36 g/mol. Its IUPAC name is 5-chloro-N-[2-[(4-chlorophenyl)disulfanyl]-5-(trifluoromethyl)phenyl]-2-hydroxybenzamide.
| Compound Name | 5-chloro-N-[2-[(4-chlorophenyl)disulfanyl]-5-(trifluoromethyl)phenyl]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 141233852 |
| Molecular Formula | C20H12Cl2F3NO2S2 |
| Molecular Weight | 490.36 g/mol |
| Exact Mass | 488.96 |
| IUPAC Name | 5-chloro-N-[2-[(4-chlorophenyl)disulfanyl]-5-(trifluoromethyl)phenyl]-2-hydroxybenzamide |
| SMILES | O=C(Nc1cc(C(F)(F)F)ccc1SSc1ccc(Cl)cc1)c1cc(Cl)ccc1O |
| InChI | InChI=1S/C20H12Cl2F3NO2S2/c21-12-2-5-14(6-3-12)29-30-18-8-1-11(20(23,24)25)9-16(18)26-19(28)15-10-13(22)4-7-17(15)27/h1-10,27H,(H,26,28) |
| InChIKey | YGVCTSSQQKJDCT-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.36 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|