C20H13ClF3NO2 — CID 166523034
5-chloro-2-hydroxy-N-[3-phenyl-5-(trifluoromethyl)phenyl]benzamide (PubChem CID 166523034) has the molecular formula C20H13ClF3NO2 and a molecular weight of 391.78 g/mol. Its IUPAC name is 5-chloro-2-hydroxy-N-[3-phenyl-5-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 5-chloro-2-hydroxy-N-[3-phenyl-5-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 166523034 |
| Molecular Formula | C20H13ClF3NO2 |
| Molecular Weight | 391.78 g/mol |
| Exact Mass | 391.06 |
| IUPAC Name | 5-chloro-2-hydroxy-N-[3-phenyl-5-(trifluoromethyl)phenyl]benzamide |
| SMILES | O=C(Nc1cc(-c2ccccc2)cc(C(F)(F)F)c1)c1cc(Cl)ccc1O |
| InChI | InChI=1S/C20H13ClF3NO2/c21-15-6-7-18(26)17(11-15)19(27)25-16-9-13(12-4-2-1-3-5-12)8-14(10-16)20(22,23)24/h1-11,26H,(H,25,27) |
| InChIKey | IRHMXFBMPNHKMO-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.78 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |