C24H15ClF3NO3 — CID 69017984
5-chloro-2-hydroxy-N-[3-naphthalen-2-yloxy-5-(trifluoromethyl)phenyl]benzamide (PubChem CID 69017984) has the molecular formula C24H15ClF3NO3 and a molecular weight of 457.84 g/mol. Its IUPAC name is 5-chloro-2-hydroxy-N-[3-naphthalen-2-yloxy-5-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 5-chloro-2-hydroxy-N-[3-naphthalen-2-yloxy-5-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 69017984 |
| Molecular Formula | C24H15ClF3NO3 |
| Molecular Weight | 457.84 g/mol |
| Exact Mass | 457.07 |
| IUPAC Name | 5-chloro-2-hydroxy-N-[3-naphthalen-2-yloxy-5-(trifluoromethyl)phenyl]benzamide |
| SMILES | O=C(Nc1cc(Oc2ccc3ccccc3c2)cc(C(F)(F)F)c1)c1cc(Cl)ccc1O |
| InChI | InChI=1S/C24H15ClF3NO3/c25-17-6-8-22(30)21(12-17)23(31)29-18-10-16(24(26,27)28)11-20(13-18)32-19-7-5-14-3-1-2-4-15(14)9-19/h1-13,30H,(H,29,31) |
| InChIKey | AEWRZBWURUNZJM-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.84 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |