C40H41Cl2F12N2O7PSi2 — CID 159931840
[2-[[3,5-bis(trifluoromethyl)phenyl]carbamoyl]-4-chlorophenyl] bis(2-trimethylsilylethyl) phosphate;N-[3,5-bis(trifluoromethyl)phenyl]-5-chloro-2-hydroxybenzamide (PubChem CID 159931840) has the molecular formula C40H41Cl2F12N2O7PSi2 and a molecular weight of 1047.80 g/mol. Its IUPAC name is [2-[[3,5-bis(trifluoromethyl)phenyl]carbamoyl]-4-chlorophenyl] bis(2-trimethylsilylethyl) phosphate;N-[3,5-bis(trifluoromethyl)phenyl]-5-chloro-2-hydroxybenzamide.
| Compound Name | [2-[[3,5-bis(trifluoromethyl)phenyl]carbamoyl]-4-chlorophenyl] bis(2-trimethylsilylethyl) phosphate;N-[3,5-bis(trifluoromethyl)phenyl]-5-chloro-2-hydroxybenzamide |
|---|---|
| PubChem CID | 159931840 |
| Molecular Formula | C40H41Cl2F12N2O7PSi2 |
| Molecular Weight | 1047.80 g/mol |
| Exact Mass | 1046.14 |
| IUPAC Name | [2-[[3,5-bis(trifluoromethyl)phenyl]carbamoyl]-4-chlorophenyl] bis(2-trimethylsilylethyl) phosphate;N-[3,5-bis(trifluoromethyl)phenyl]-5-chloro-2-hydroxybenzamide |
| SMILES | C[Si](C)(C)CCOP(=O)(OCC[Si](C)(C)C)Oc1ccc(Cl)cc1C(=O)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1.O=C(Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1cc(Cl)ccc1O |
| InChI | InChI=1S/C25H33ClF6NO5PSi2.C15H8ClF6NO2/c1-40(2,3)11-9-36-39(35,37-10-12-41(4,5)6)38-22-8-7-19(26)16-21(22)23(34)33-20-14-17(24(27,28)29)13-18(15-20)25(30,31)32;16-9-1-2-12(24)11(6-9)13(25)23-10-4-7(14(17,18)19)3-8(5-10)15(20,21)22/h7-8,13-16H,9-12H2,1-6H3,(H,33,34);1-6,24H,(H,23,25) |
| InChIKey | NZSXPLSCXKHKLG-UHFFFAOYSA-N |
| XLogP | 15.16 |
| TPSA | 123.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1047.80 |
| LogP ≤ 5 | 15.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|