C19H17ClF6N2O5 — CID 175096861
2-[bis(2-hydroxyethoxy)amino]-N-[3,5-bis(trifluoromethyl)phenyl]-5-chlorobenzamide (PubChem CID 175096861) has the molecular formula C19H17ClF6N2O5 and a molecular weight of 502.80 g/mol. Its IUPAC name is 2-[bis(2-hydroxyethoxy)amino]-N-[3,5-bis(trifluoromethyl)phenyl]-5-chlorobenzamide.
| Compound Name | 2-[bis(2-hydroxyethoxy)amino]-N-[3,5-bis(trifluoromethyl)phenyl]-5-chlorobenzamide |
|---|---|
| PubChem CID | 175096861 |
| Molecular Formula | C19H17ClF6N2O5 |
| Molecular Weight | 502.80 g/mol |
| Exact Mass | 502.07 |
| IUPAC Name | 2-[bis(2-hydroxyethoxy)amino]-N-[3,5-bis(trifluoromethyl)phenyl]-5-chlorobenzamide |
| SMILES | O=C(Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1cc(Cl)ccc1N(OCCO)OCCO |
| InChI | InChI=1S/C19H17ClF6N2O5/c20-13-1-2-16(28(32-5-3-29)33-6-4-30)15(10-13)17(31)27-14-8-11(18(21,22)23)7-12(9-14)19(24,25)26/h1-2,7-10,29-30H,3-6H2,(H,27,31) |
| InChIKey | CFEYNKSFADGFKP-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 91.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.80 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|