C15H9ClF3NO3 — CID 85472840
2-[[3-chloro-5-(trifluoromethyl)phenyl]carbamoyl]benzoic acid (PubChem CID 85472840) has the molecular formula C15H9ClF3NO3 and a molecular weight of 343.69 g/mol. Its IUPAC name is 2-[[3-chloro-5-(trifluoromethyl)phenyl]carbamoyl]benzoic acid.
| Compound Name | 2-[[3-chloro-5-(trifluoromethyl)phenyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 85472840 |
| Molecular Formula | C15H9ClF3NO3 |
| Molecular Weight | 343.69 g/mol |
| Exact Mass | 343.02 |
| IUPAC Name | 2-[[3-chloro-5-(trifluoromethyl)phenyl]carbamoyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1C(=O)Nc1cc(Cl)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H9ClF3NO3/c16-9-5-8(15(17,18)19)6-10(7-9)20-13(21)11-3-1-2-4-12(11)14(22)23/h1-7H,(H,20,21)(H,22,23) |
| InChIKey | YOHGCKVZCJDONQ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.69 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |