C13H8ClF3N2O2 — CID 116700273
N-[3-chloro-5-(trifluoromethyl)phenyl]-3-hydroxypyridine-4-carboxamide (PubChem CID 116700273) has the molecular formula C13H8ClF3N2O2 and a molecular weight of 316.67 g/mol. Its IUPAC name is N-[3-chloro-5-(trifluoromethyl)phenyl]-3-hydroxypyridine-4-carboxamide.
| Compound Name | N-[3-chloro-5-(trifluoromethyl)phenyl]-3-hydroxypyridine-4-carboxamide |
|---|---|
| PubChem CID | 116700273 |
| Molecular Formula | C13H8ClF3N2O2 |
| Molecular Weight | 316.67 g/mol |
| Exact Mass | 316.02 |
| IUPAC Name | N-[3-chloro-5-(trifluoromethyl)phenyl]-3-hydroxypyridine-4-carboxamide |
| SMILES | O=C(Nc1cc(Cl)cc(C(F)(F)F)c1)c1ccncc1O |
| InChI | InChI=1S/C13H8ClF3N2O2/c14-8-3-7(13(15,16)17)4-9(5-8)19-12(21)10-1-2-18-6-11(10)20/h1-6,20H,(H,19,21) |
| InChIKey | UBWIQEQHYOUKFC-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.67 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |