C18H14ClF6INO5PS2 — CID 167058560
[2-[[3,5-bis(trifluoromethyl)phenyl]carbamoyl]-4-chlorophenyl] iodosulfanylmethyl 2-sulfanylethyl phosphate (PubChem CID 167058560) has the molecular formula C18H14ClF6INO5PS2 and a molecular weight of 695.76 g/mol. Its IUPAC name is [2-[[3,5-bis(trifluoromethyl)phenyl]carbamoyl]-4-chlorophenyl] iodosulfanylmethyl 2-sulfanylethyl phosphate.
| Compound Name | [2-[[3,5-bis(trifluoromethyl)phenyl]carbamoyl]-4-chlorophenyl] iodosulfanylmethyl 2-sulfanylethyl phosphate |
|---|---|
| PubChem CID | 167058560 |
| Molecular Formula | C18H14ClF6INO5PS2 |
| Molecular Weight | 695.76 g/mol |
| Exact Mass | 694.87 |
| IUPAC Name | [2-[[3,5-bis(trifluoromethyl)phenyl]carbamoyl]-4-chlorophenyl] iodosulfanylmethyl 2-sulfanylethyl phosphate |
| SMILES | O=C(Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1cc(Cl)ccc1OP(=O)(OCCS)OCSI |
| InChI | InChI=1S/C18H14ClF6INO5PS2/c19-12-1-2-15(32-33(29,30-3-4-34)31-9-35-26)14(8-12)16(28)27-13-6-10(17(20,21)22)5-11(7-13)18(23,24)25/h1-2,5-8,34H,3-4,9H2,(H,27,28) |
| InChIKey | YUCDZZHSHJAQJU-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.76 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|