C33H30F6NO3P — CID 141224231
N-[3,5-bis(trifluoromethyl)phenyl]-5-tert-butyl-2-dibenzylphosphoryloxybenzamide (PubChem CID 141224231) has the molecular formula C33H30F6NO3P and a molecular weight of 633.57 g/mol. Its IUPAC name is N-[3,5-bis(trifluoromethyl)phenyl]-5-tert-butyl-2-dibenzylphosphoryloxybenzamide.
| Compound Name | N-[3,5-bis(trifluoromethyl)phenyl]-5-tert-butyl-2-dibenzylphosphoryloxybenzamide |
|---|---|
| PubChem CID | 141224231 |
| Molecular Formula | C33H30F6NO3P |
| Molecular Weight | 633.57 g/mol |
| Exact Mass | 633.19 |
| IUPAC Name | N-[3,5-bis(trifluoromethyl)phenyl]-5-tert-butyl-2-dibenzylphosphoryloxybenzamide |
| SMILES | CC(C)(C)c1ccc(OP(=O)(Cc2ccccc2)Cc2ccccc2)c(C(=O)Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C33H30F6NO3P/c1-31(2,3)24-14-15-29(43-44(42,20-22-10-6-4-7-11-22)21-23-12-8-5-9-13-23)28(19-24)30(41)40-27-17-25(32(34,35)36)16-26(18-27)33(37,38)39/h4-19H,20-21H2,1-3H3,(H,40,41) |
| InChIKey | UDMHKHQJNMBFHL-UHFFFAOYSA-N |
| XLogP | 10.33 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.57 |
| LogP ≤ 5 | 10.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|