C29H29F6N3OS — CID 135024080
(2S)-N,N-dibenzyl-2-[[3,5-bis(trifluoromethyl)phenyl]carbamothioylamino]-3,3-dimethylbutanamide (PubChem CID 135024080) has the molecular formula C29H29F6N3OS and a molecular weight of 581.63 g/mol. Its IUPAC name is (2S)-N,N-dibenzyl-2-[[3,5-bis(trifluoromethyl)phenyl]carbamothioylamino]-3,3-dimethylbutanamide.
| Compound Name | (2S)-N,N-dibenzyl-2-[[3,5-bis(trifluoromethyl)phenyl]carbamothioylamino]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 135024080 |
| Molecular Formula | C29H29F6N3OS |
| Molecular Weight | 581.63 g/mol |
| Exact Mass | 581.19 |
| IUPAC Name | (2S)-N,N-dibenzyl-2-[[3,5-bis(trifluoromethyl)phenyl]carbamothioylamino]-3,3-dimethylbutanamide |
| SMILES | CC(C)(C)[C@H](NC(=S)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1)C(=O)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C29H29F6N3OS/c1-27(2,3)24(25(39)38(17-19-10-6-4-7-11-19)18-20-12-8-5-9-13-20)37-26(40)36-23-15-21(28(30,31)32)14-22(16-23)29(33,34)35/h4-16,24H,17-18H2,1-3H3,(H2,36,37,40)/t24-/m1/s1 |
| InChIKey | SCFOLJRRPNUACK-XMMPIXPASA-N |
| XLogP | 7.65 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.63 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|