C20H25N3OS — CID 102278044
(2S)-N-benzyl-3,3-dimethyl-2-(phenylcarbamothioylamino)butanamide (PubChem CID 102278044) has the molecular formula C20H25N3OS and a molecular weight of 355.51 g/mol. Its IUPAC name is (2S)-N-benzyl-3,3-dimethyl-2-(phenylcarbamothioylamino)butanamide.
| Compound Name | (2S)-N-benzyl-3,3-dimethyl-2-(phenylcarbamothioylamino)butanamide |
|---|---|
| PubChem CID | 102278044 |
| Molecular Formula | C20H25N3OS |
| Molecular Weight | 355.51 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | (2S)-N-benzyl-3,3-dimethyl-2-(phenylcarbamothioylamino)butanamide |
| SMILES | CC(C)(C)[C@H](NC(=S)Nc1ccccc1)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C20H25N3OS/c1-20(2,3)17(18(24)21-14-15-10-6-4-7-11-15)23-19(25)22-16-12-8-5-9-13-16/h4-13,17H,14H2,1-3H3,(H,21,24)(H2,22,23,25)/t17-/m1/s1 |
| InChIKey | MIGWVHBQTMSRNE-QGZVFWFLSA-N |
| XLogP | 3.70 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.51 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|